ChemNet > CAS > 5147-80-8 2-(bis(methylthio)methylene)malononitrile
5147-80-8 2-(bis(methylthio)methylene)malononitrile
| Ονομασία του προϊόντος |
2-(bis(methylthio)methylene)malononitrile |
| Συνώνυμα |
2-[Di(methylthio)methylidene]malononitrile; [bis(methylsulfanyl)methylidene]propanedinitrile |
| MF |
C6H6N2S2 |
| Μοριακό βάρος |
170.2552 |
| InChI |
InChI=1/C6H6N2S2/c1-9-6(10-2)5(3-7)4-8/h1-2H3 |
| CAS ΟΧΙ |
5147-80-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.256g/cm3 |
| Σημείο τήξης |
76℃ |
| Σημείο βρασμού |
248.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.584 |
| Σημείο ανάφλεξης |
103.9°C |
| Σύμβολα επικινδυνότητας |
 T:Toxic;
|
| Κινδύνου Κώδικες |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
