ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
| Ονομασία του προϊόντος |
4-Iodophenylacetonitrile |
| Συνώνυμα |
4-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Μοριακό βάρος |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
| CAS ΟΧΙ |
51628-12-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.764g/cm3 |
| Σημείο βρασμού |
285.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.624 |
| Σημείο ανάφλεξης |
126.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
