ChemNet > CAS > 51632-28-1 4-Ethylphenylacetonitrile
51632-28-1 4-Ethylphenylacetonitrile
| Ονομασία του προϊόντος |
4-Ethylphenylacetonitrile |
| Συνώνυμα |
4-Ethylbenzyl cyanide |
| MF |
C10H11N |
| Μοριακό βάρος |
145.201 |
| InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
| CAS ΟΧΙ |
51632-28-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.978g/cm3 |
| Σημείο βρασμού |
252.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.521 |
| Σημείο ανάφλεξης |
116.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
