ChemNet > CAS > 51660-08-3 5-chloro-6-phenylpyridazin-3-ol
51660-08-3 5-chloro-6-phenylpyridazin-3-ol
| Ονομασία του προϊόντος |
5-chloro-6-phenylpyridazin-3-ol |
| Συνώνυμα |
5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
| MF |
C10H7ClN2O |
| Μοριακό βάρος |
206.6284 |
| InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| CAS ΟΧΙ |
51660-08-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.35g/cm3 |
| Σημείο τήξης |
235℃ |
| Σημείο βρασμού |
403.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.641 |
| Σημείο ανάφλεξης |
197.7°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
