ChemNet > CAS > 51707-38-1 3,4-Dimethoxybenzhydrazide
51707-38-1 3,4-Dimethoxybenzhydrazide
Ονομασία του προϊόντος |
3,4-Dimethoxybenzhydrazide |
Συνώνυμα |
3,5-dimethoxybenzohydrazide; 3,5-Dimethoxybenzhydrazide |
MF |
C9H12N2O3 |
Μοριακό βάρος |
196.2032 |
InChI |
InChI=1/C9H12N2O3/c1-13-7-3-6(9(12)11-10)4-8(5-7)14-2/h3-5H,10H2,1-2H3,(H,11,12) |
CAS ΟΧΙ |
51707-38-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.189g/cm3 |
Σημείο τήξης |
143-144℃ |
Δείκτης διάθλασης |
1.544 |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|