ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
| Ονομασία του προϊόντος |
2,5-Dibromo-3,4-dinitrothiophene |
| Συνώνυμα |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| MF |
C4Br2N2O4S |
| Μοριακό βάρος |
331.9268 |
| InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| CAS ΟΧΙ |
52431-30-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.459g/cm3 |
| Σημείο βρασμού |
341.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.716 |
| Σημείο ανάφλεξης |
160.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
