ChemNet > CAS > 53001-74-4 2,3,4,5-Tetrafluorophenylacetonitrile
53001-74-4 2,3,4,5-Tetrafluorophenylacetonitrile
| Ονομασία του προϊόντος |
2,3,4,5-Tetrafluorophenylacetonitrile |
| Συνώνυμα |
2,3,4,5-Tetrafluorobenzyl cyanide |
| MF |
C8H3F4N |
| Μοριακό βάρος |
189.1097 |
| InChI |
InChI=1/C8H3F4N/c9-5-3-4(1-2-13)6(10)8(12)7(5)11/h3H,1H2 |
| CAS ΟΧΙ |
53001-74-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.427g/cm3 |
| Σημείο βρασμού |
208.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.451 |
| Σημείο ανάφλεξης |
103.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
