ChemNet > CAS > 535-32-0 D-Ethionine
535-32-0 D-Ethionine
Ονομασία του προϊόντος |
D-Ethionine |
Συνώνυμα |
D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
MF |
C6H13NO2S |
Μοριακό βάρος |
163.2379 |
InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
CAS ΟΧΙ |
535-32-0 |
EINECS |
208-612-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.164g/cm3 |
Σημείο τήξης |
278℃ |
Σημείο βρασμού |
310.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.523 |
Σημείο ανάφλεξης |
141.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R40:Possible risks of irreversible effects.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|