ChemNet > CAS > 539-44-6 p-tolylhydrazine
539-44-6 p-tolylhydrazine
| Ονομασία του προϊόντος |
p-tolylhydrazine |
| Συνώνυμα |
4-Methylphenylhydrazine; (4-methylphenyl)hydrazine hydrochloride (1:1) |
| MF |
C7H11ClN2 |
| Μοριακό βάρος |
158.6286 |
| InChI |
InChI=1/C7H10N2.ClH/c1-6-2-4-7(9-8)5-3-6;/h2-5,9H,8H2,1H3;1H |
| CAS ΟΧΙ |
539-44-6 |
| EINECS |
208-717-2 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
242.8°C at 760 mmHg |
| Σημείο ανάφλεξης |
115.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
