ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
Ονομασία του προϊόντος |
p-Diethylaminoacetophenone |
Συνώνυμα |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
MF |
C12H17NO |
Μοριακό βάρος |
191.2695 |
InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
CAS ΟΧΙ |
5520-66-1 |
Μοριακή δομή |
|
Πυκνότητα |
0.996g/cm3 |
Σημείο βρασμού |
313.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.536 |
Σημείο ανάφλεξης |
114.4°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|