ChemNet > CAS > 5520-66-1 p-Diethylaminoacetophenone
5520-66-1 p-Diethylaminoacetophenone
| Ονομασία του προϊόντος |
p-Diethylaminoacetophenone |
| Συνώνυμα |
4-Diethylaminoacetophenone; 1-[4-(diethylamino)phenyl]ethanone |
| MF |
C12H17NO |
| Μοριακό βάρος |
191.2695 |
| InChI |
InChI=1/C12H17NO/c1-4-13(5-2)12-8-6-11(7-9-12)10(3)14/h6-9H,4-5H2,1-3H3 |
| CAS ΟΧΙ |
5520-66-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.996g/cm3 |
| Σημείο βρασμού |
313.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.536 |
| Σημείο ανάφλεξης |
114.4°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
