ChemNet > CAS > 58971-11-2 3-Bromophenethylamine
58971-11-2 3-Bromophenethylamine
| Ονομασία του προϊόντος |
3-Bromophenethylamine |
| Συνώνυμα |
2-(3-bromophenyl)ethanaminium; 2-(3-bromophenyl)ethanamine; 3-Bromo-benzeneethanamine |
| MF |
C8H10BrN |
| Μοριακό βάρος |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2 |
| CAS ΟΧΙ |
58971-11-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.407g/cm3 |
| Σημείο βρασμού |
263.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.575 |
| Σημείο ανάφλεξης |
113.1°C |
| Σύμβολα επικινδυνότητας |
 C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
