ChemNet > CAS > 59-82-5 5-Nitro-2-furonitrile
59-82-5 5-Nitro-2-furonitrile
| Ονομασία του προϊόντος |
5-Nitro-2-furonitrile |
| Συνώνυμα |
5-Nitro-2-furancarbonitrile; 5-nitrofuran-2-carbonitrile |
| MF |
C5H2N2O3 |
| Μοριακό βάρος |
138.081 |
| InChI |
InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS ΟΧΙ |
59-82-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.46g/cm3 |
| Σημείο βρασμού |
234.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.544 |
| Σημείο ανάφλεξης |
95.7°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
