ChemNet > CAS > 59548-39-9 4-Methoxy-o-phenylenediamine dihydrochloride
59548-39-9 4-Methoxy-o-phenylenediamine dihydrochloride
| Ονομασία του προϊόντος |
4-Methoxy-o-phenylenediamine dihydrochloride |
| Συνώνυμα |
3,4-Diaminoanisole dihydrochloride; 4-methoxybenzene-1,2-diamine dihydrochloride |
| MF |
C7H12Cl2N2O |
| Μοριακό βάρος |
211.089 |
| InChI |
InChI=1/C7H10N2O.2ClH/c1-10-5-2-3-6(8)7(9)4-5;;/h2-4H,8-9H2,1H3;2*1H |
| CAS ΟΧΙ |
59548-39-9 |
| EINECS |
261-801-0 |
| Μοριακή δομή |
|
| Σημείο τήξης |
210-209℃ |
| Σημείο βρασμού |
302.4°C at 760 mmHg |
| Σημείο ανάφλεξης |
161.7°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
