ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
Ονομασία του προϊόντος |
3-Hydroxy-2-nitrobenzoic acid |
MF |
C7H5NO5 |
Μοριακό βάρος |
183.1183 |
InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
CAS ΟΧΙ |
602-00-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.631g/cm3 |
Σημείο βρασμού |
362.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.663 |
Σημείο ανάφλεξης |
166.7°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|