ChemNet > CAS > 614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
614-10-8 4-(2-Methylphenyl)-3-thiosemicarbazide
| Ονομασία του προϊόντος |
4-(2-Methylphenyl)-3-thiosemicarbazide |
| Συνώνυμα |
4-(o-Tolyl)-3-thiosemicarbazide; N-(2-methylphenyl)hydrazinecarbothioamide; 2-(2-methylphenyl)hydrazinecarbothioamide |
| MF |
C8H11N3S |
| Μοριακό βάρος |
181.258 |
| InChI |
InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
| CAS ΟΧΙ |
614-10-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.27g/cm3 |
| Σημείο βρασμού |
295.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.699 |
| Σημείο ανάφλεξης |
132.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R25:Toxic if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
