ChemNet > CAS > 615-74-7 2-Chloro-5-methylphenol
615-74-7 2-Chloro-5-methylphenol
| Ονομασία του προϊόντος |
2-Chloro-5-methylphenol |
| Συνώνυμα |
4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
| MF |
C7H7ClO |
| Μοριακό βάρος |
142.58 |
| InChI |
InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| CAS ΟΧΙ |
615-74-7 |
| EINECS |
210-444-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.215 |
| Σημείο τήξης |
45-48℃ |
| Σημείο βρασμού |
196℃ |
| Σημείο ανάφλεξης |
81℃ |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R21/22:Harmful in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
