ChemNet > CAS > 6326-44-9 Diethyl formamidomalonate
6326-44-9 Diethyl formamidomalonate
| Ονομασία του προϊόντος |
Diethyl formamidomalonate |
| Συνώνυμα |
Formamidomalonic acid diethyl ester; diethyl (formylamino)propanedioate; Diethylformamidomalonate |
| MF |
C8H13NO5 |
| Μοριακό βάρος |
203.1925 |
| InChI |
InChI=1/C8H13NO5/c1-3-13-7(11)6(9-5-10)8(12)14-4-2/h5-6H,3-4H2,1-2H3,(H,9,10) |
| CAS ΟΧΙ |
6326-44-9 |
| EINECS |
228-692-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.167g/cm3 |
| Σημείο τήξης |
51-56℃ |
| Σημείο βρασμού |
316.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.445 |
| Σημείο ανάφλεξης |
165.7°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
