ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
| Ονομασία του προϊόντος |
1-(2,6-Dimethylphenyl)-thiourea |
| Συνώνυμα |
2,6-Dimethylphenylthiourea |
| MF |
C9H12N2S |
| Μοριακό βάρος |
180.27 |
| InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
| CAS ΟΧΙ |
6396-76-5 |
| EINECS |
229-005-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.2g/cm3 |
| Σημείο βρασμού |
284.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.674 |
| Σημείο ανάφλεξης |
125.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R25:Toxic if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
