ChemNet > CAS > 67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
67073-39-6 4-Chloro-5-nitro-o-phenylenediamine
Ονομασία του προϊόντος |
4-Chloro-5-nitro-o-phenylenediamine |
Συνώνυμα |
4-chloro-5-nitrobenzene-1,2-diamine |
MF |
C6H6ClN3O2 |
Μοριακό βάρος |
187.5837 |
InChI |
InChI=1/C6H6ClN3O2/c7-3-1-4(8)5(9)2-6(3)10(11)12/h1-2H,8-9H2 |
CAS ΟΧΙ |
67073-39-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.592g/cm3 |
Σημείο τήξης |
189℃ |
Σημείο βρασμού |
458.9°C at 760 mmHg |
Δείκτης διάθλασης |
1.712 |
Σημείο ανάφλεξης |
231.3°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|