ChemNet > CAS > 69321-60-4 2,6-Dibromotoluene
69321-60-4 2,6-Dibromotoluene
| Ονομασία του προϊόντος |
2,6-Dibromotoluene |
| Συνώνυμα |
1,3-dibromo-2-methylbenzene |
| MF |
C7H6Br2 |
| Μοριακό βάρος |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
| CAS ΟΧΙ |
69321-60-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.81g/cm3 |
| Σημείο βρασμού |
246°C at 760 mmHg |
| Δείκτης διάθλασης |
1.587 |
| Σημείο ανάφλεξης |
106.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
