ChemNet > CAS > 697-86-9 2-Bromo-4,6-dichloroaniline
697-86-9 2-Bromo-4,6-dichloroaniline
| Ονομασία του προϊόντος |
2-Bromo-4,6-dichloroaniline |
| Συνώνυμα |
2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
| MF |
C6H4BrCl2N |
| Μοριακό βάρος |
240.9127 |
| InChI |
InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| CAS ΟΧΙ |
697-86-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.827g/cm3 |
| Σημείο βρασμού |
273°C at 760 mmHg |
| Δείκτης διάθλασης |
1.648 |
| Σημείο ανάφλεξης |
121.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
