ChemNet > CAS > 6992-84-3 3,6-Diamino-2-picoline
6992-84-3 3,6-Diamino-2-picoline
| Ονομασία του προϊόντος |
3,6-Diamino-2-picoline |
| Συνώνυμα |
6-methylpyridine-2,5-diamine; 3,6-diamino-2-methylpyridinium |
| MF |
C6H10N3 |
| Μοριακό βάρος |
124.1632 |
| InChI |
InChI=1/C6H9N3/c1-4-5(7)2-3-6(8)9-4/h2-3H,7H2,1H3,(H2,8,9)/p+1 |
| CAS ΟΧΙ |
6992-84-3 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
307.4°C at 760 mmHg |
| Σημείο ανάφλεξης |
165.2°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
