ChemNet > CAS > 700-96-9 3,4-Dimethoxythiophenol
700-96-9 3,4-Dimethoxythiophenol
| Ονομασία του προϊόντος |
3,4-Dimethoxythiophenol |
| Συνώνυμα |
3,4-Dimethoxybenzenethiol |
| MF |
C8H10O2S |
| Μοριακό βάρος |
170.22 |
| InChI |
InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
| CAS ΟΧΙ |
700-96-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.19 |
| Σημείο βρασμού |
110℃(1 torr) |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
