ChemNet > CAS > 72065-23-7 N-Acryloylsarcosine methyl ester
72065-23-7 N-Acryloylsarcosine methyl ester
| Ονομασία του προϊόντος |
N-Acryloylsarcosine methyl ester |
| Συνώνυμα |
methyl N-acryloyl-N-methylglycinate |
| MF |
C7H11NO3 |
| Μοριακό βάρος |
157.1671 |
| InChI |
InChI=1/C7H11NO3/c1-4-6(9)8(2)5-7(10)11-3/h4H,1,5H2,2-3H3 |
| CAS ΟΧΙ |
72065-23-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.068g/cm3 |
| Σημείο βρασμού |
276.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.452 |
| Σημείο ανάφλεξης |
120.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
