ChemNet > CAS > 7650-84-2 diphenylpropylphosphine
7650-84-2 diphenylpropylphosphine
Ονομασία του προϊόντος |
diphenylpropylphosphine |
Συνώνυμα |
Diphenyl-n-propylphosphine; n-Propyldiphenylphosphine; Diphenyln-propylphosphine; diphenyl(propyl)phosphane |
MF |
C15H17P |
Μοριακό βάρος |
228.2692 |
InChI |
InChI=1/C15H17P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
CAS ΟΧΙ |
7650-84-2 |
EINECS |
231-607-0 |
Μοριακή δομή |
|
Σημείο βρασμού |
304.1°C at 760 mmHg |
Σημείο ανάφλεξης |
150.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|