ChemNet > CAS > 78881-21-7 4-Amino-3-methylbenzonitrile
78881-21-7 4-Amino-3-methylbenzonitrile
Ονομασία του προϊόντος |
4-Amino-3-methylbenzonitrile |
Συνώνυμα |
4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
MF |
C8H8N2 |
Μοριακό βάρος |
132.1625 |
InChI |
InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
CAS ΟΧΙ |
78881-21-7 |
Μοριακή δομή |
|
Πυκνότητα |
1.1g/cm3 |
Σημείο βρασμού |
304.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.575 |
Σημείο ανάφλεξης |
138°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|