ChemNet > CAS > 79676-56-5 2-(Difluoromethylthio)benzoic acid
79676-56-5 2-(Difluoromethylthio)benzoic acid
| Ονομασία του προϊόντος |
2-(Difluoromethylthio)benzoic acid |
| Συνώνυμα |
2-[(difluoromethyl)sulfanyl]benzoate; 2-[(difluoromethyl)sulfanyl]benzoic acid; 2-[(difluoromethyl)sulfanyl]benzoyl chloride |
| MF |
C8H5ClF2OS |
| Μοριακό βάρος |
222.6395 |
| InChI |
InChI=1/C8H5ClF2OS/c9-7(12)5-3-1-2-4-6(5)13-8(10)11/h1-4,8H |
| CAS ΟΧΙ |
79676-56-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.42g/cm3 |
| Σημείο βρασμού |
236.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.541 |
| Σημείο ανάφλεξης |
96.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
