ChemNet > CAS > 80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
80500-27-2 4-Methyl-3-nitrobenzeneboronic acid
Ονομασία του προϊόντος |
4-Methyl-3-nitrobenzeneboronic acid |
Συνώνυμα |
4-Methyl-3-nitrophenylboronic acid; 3-Nitro-p-tolylboronic acid; (4-methyl-3-nitrophenyl)boronic acid; 4-methyl-3-nitrophenylboronic acid; 3-Nitropheny-4-methylphenylboronic acid |
MF |
C7H8BNO4 |
Μοριακό βάρος |
180.9537 |
InChI |
InChI=1/C7H8BNO4/c1-5-2-3-6(8(10)11)4-7(5)9(12)13/h2-4,10-11H,1H3 |
CAS ΟΧΙ |
80500-27-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.33g/cm3 |
Σημείο τήξης |
265-270 °C(lit.) |
Σημείο βρασμού |
356.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.563 |
Σημείο ανάφλεξης |
169.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|