ChemNet > CAS > 81067-38-1 1-Bromo-2,3,5-trichlorobenzene
81067-38-1 1-Bromo-2,3,5-trichlorobenzene
| Ονομασία του προϊόντος |
1-Bromo-2,3,5-trichlorobenzene |
| Συνώνυμα |
2,3,5-Trichlorobromobenzene |
| MF |
C6H2BrCl3 |
| Μοριακό βάρος |
260.3431 |
| InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| CAS ΟΧΙ |
81067-38-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.84g/cm3 |
| Σημείο τήξης |
58-61℃ |
| Σημείο βρασμού |
270.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.603 |
| Σημείο ανάφλεξης |
129.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
