ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
Ονομασία του προϊόντος |
iodopentafluorobenzene |
Συνώνυμα |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
MF |
C6F5I |
Μοριακό βάρος |
293.9607 |
InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
CAS ΟΧΙ |
827-15-6 |
EINECS |
212-565-2 |
Μοριακή δομή |
|
Πυκνότητα |
2.217g/cm3 |
Σημείο βρασμού |
166.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.502 |
Σημείο ανάφλεξης |
61.3°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|