ChemNet > CAS > 84282-78-0 3-chloro-4-fluorophenylhydrazine
84282-78-0 3-chloro-4-fluorophenylhydrazine
| Ονομασία του προϊόντος |
3-chloro-4-fluorophenylhydrazine |
| MF |
C6H6ClFN2 |
| Μοριακό βάρος |
160.5766 |
| InChI |
InChI=1/C6H6ClFN2/c7-5-3-4(10-9)1-2-6(5)8/h1-3,10H,9H2 |
| CAS ΟΧΙ |
84282-78-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.43g/cm3 |
| Σημείο τήξης |
62-63℃ |
| Σημείο βρασμού |
253.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.624 |
| Σημείο ανάφλεξης |
106.9°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
