ChemNet > CAS > 89787-12-2 (2-Isopropylphenyl)boronic acid
89787-12-2 (2-Isopropylphenyl)boronic acid
| Ονομασία του προϊόντος |
(2-Isopropylphenyl)boronic acid |
| Συνώνυμα |
2-Isopropylbenzeneboronic acid; 2-Cumylboronic acid~2-Isopropylphenylboronic acid; [2-(1-methylethyl)phenyl]boronic acid; 2-Isopropylphenylboronic Acid |
| MF |
C9H13BO2 |
| Μοριακό βάρος |
164.0093 |
| InChI |
InChI=1/C9H13BO2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7,11-12H,1-2H3 |
| CAS ΟΧΙ |
89787-12-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.04g/cm3 |
| Σημείο βρασμού |
297.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.513 |
| Σημείο ανάφλεξης |
133.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
