ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
Ονομασία του προϊόντος |
poly(chlorotrifluoroethylene) |
Συνώνυμα |
halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
MF |
C2ClF3 |
Μοριακό βάρος |
116.4693 |
InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
CAS ΟΧΙ |
9002-83-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.9 |
Σημείο τήξης |
210℃ |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|