ChemNet > CAS > 9010-77-9 Ethylene/acrylic acid copolymer
9010-77-9 Ethylene/acrylic acid copolymer
Ονομασία του προϊόντος |
Ethylene/acrylic acid copolymer |
Συνώνυμα |
Poly(ethylene-co-acrylic acid); Ethylene-acrylic acid resin (90/10; prop-2-enoic acid - ethene (1:1); Ethylene acrylic acid copolymer; EAA |
MF |
C5H8O2 |
Μοριακό βάρος |
100.1158 |
InChI |
InChI=1/C3H4O2.C2H4/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H2 |
CAS ΟΧΙ |
9010-77-9 |
Μοριακή δομή |
|
Σημείο τήξης |
87-101℃ |
Σημείο βρασμού |
141°C at 760 mmHg |
Σημείο ανάφλεξης |
61.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|