ChemNet > CAS > 9010-85-9 poly(isobutylene-co-isoprene)
9010-85-9 poly(isobutylene-co-isoprene)
Ονομασία του προϊόντος |
poly(isobutylene-co-isoprene) |
Συνώνυμα |
Isobutylene/isoprene copolymer; 2-Methyl-1,3-butadiene polymer with 2-methyl-1-propene; Butyl rubber; 1,3-Butadiene, 2-methyl-, polymer with 2-methyl-1-propene; Poly(isobutylene-co-isoprene); 2-methylbuta-1,3-diene - 2-methylprop-1-ene (1:1) |
MF |
C9H16 |
Μοριακό βάρος |
124.2233 |
InChI |
InChI=1/C5H8.C4H8/c1-4-5(2)3;1-4(2)3/h4H,1-2H2,3H3;1H2,2-3H3 |
CAS ΟΧΙ |
9010-85-9 |
Μοριακή δομή |
|
Σημείο βρασμού |
34.1°C at 760 mmHg |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|