ChemNet > CAS > 939-83-3 2-Methyl-5-nitrobenzonitrile
939-83-3 2-Methyl-5-nitrobenzonitrile
| Ονομασία του προϊόντος |
2-Methyl-5-nitrobenzonitrile |
| Συνώνυμα |
5-Nitro-o-tolunitrile |
| MF |
C8H6N2O2 |
| Μοριακό βάρος |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| CAS ΟΧΙ |
939-83-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.26g/cm3 |
| Σημείο τήξης |
103.5-107.5℃ |
| Σημείο βρασμού |
291.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.568 |
| Σημείο ανάφλεξης |
130.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
