ChemNet > CAS > 942-92-7 Hexanophenone
942-92-7 Hexanophenone
| Ονομασία του προϊόντος |
Hexanophenone |
| Συνώνυμα |
n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| MF |
C12H16O |
| Μοριακό βάρος |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| CAS ΟΧΙ |
942-92-7 |
| EINECS |
213-394-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.942g/cm3 |
| Σημείο τήξης |
25-26℃ |
| Σημείο βρασμού |
265°C at 760 mmHg |
| Δείκτης διάθλασης |
1.498 |
| Σημείο ανάφλεξης |
105.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
