ChemNet > CAS > 95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
95201-93-7 Methyl 4-bromo-3-hydroxythiophene-2-carboxylate
| Ονομασία του προϊόντος |
Methyl 4-bromo-3-hydroxythiophene-2-carboxylate |
| Συνώνυμα |
4-bromo-2-[hydroxy(methoxy)methylidene]thiophen-3(2H)-one |
| MF |
C6H5BrO3S |
| Μοριακό βάρος |
237.0711 |
| InChI |
InChI=1/C6H5BrO3S/c1-10-6(9)5-4(8)3(7)2-11-5/h2,8H,1H3 |
| CAS ΟΧΙ |
95201-93-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.804g/cm3 |
| Σημείο τήξης |
79-80℃ |
| Σημείο βρασμού |
247.887°C at 760 mmHg |
| Δείκτης διάθλασης |
1.617 |
| Σημείο ανάφλεξης |
103.718°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
