ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
| Ονομασία του προϊόντος |
2-(Difluoromethoxy)benzoic acid |
| Συνώνυμα |
2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
| MF |
C8H6F2O3 |
| Μοριακό βάρος |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
| CAS ΟΧΙ |
97914-59-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.37g/cm3 |
| Σημείο βρασμού |
273.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.496 |
| Σημείο ανάφλεξης |
119.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
