ChemNet > CAS > 100-80-1 m-Vinyltoluene
100-80-1 m-Vinyltoluene
termék neve |
m-Vinyltoluene |
Szinonimák |
3-Methylstyrene; 3-Vinyltoluene |
MF |
C9H10 |
Molekulatömeg |
118.17 |
InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
CAS-szám |
100-80-1 |
EINECS |
202-889-2 |
Molekuláris szerkezete |
|
Sűrűség |
170 |
Forráspont |
171℃ |
Veszély szimbólumok |
|
Kockázatot kódok |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|