ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
termék neve |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
MF |
C7H11FO2 |
Molekulatömeg |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
CAS-szám |
1171-47-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.159g/cm3 |
Forráspont |
227.566°C at 760 mmHg |
Törésmutató |
1.454 |
Gyulladáspont |
91.429°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|