ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
termék neve |
4-(Dimethylamino)benzonitrile |
Szinonimák |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
MF |
C9H10N2 |
Molekulatömeg |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
CAS-szám |
1197-19-9 |
EINECS |
214-819-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.04g/cm3 |
Olvadáspont |
70-76℃ |
Forráspont |
318.8°C at 760 mmHg |
Törésmutató |
1.55 |
Gyulladáspont |
145.4°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|