ChemNet > CAS > 132741-29-8 Difluoromandelicacid
132741-29-8 Difluoromandelicacid
termék neve |
Difluoromandelicacid |
Szinonimák |
3,4-Difluoromandelic acid; (3,4-difluorophenyl)(hydroxy)acetic acid |
MF |
C8H6F2O3 |
Molekulatömeg |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
CAS-szám |
132741-29-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.522g/cm3 |
Olvadáspont |
92-94℃ |
Forráspont |
320.7°C at 760 mmHg |
Törésmutató |
1.542 |
Gyulladáspont |
147.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|