ChemNet > CAS > 13322-02-6 4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole
13322-02-6 4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole
termék neve |
4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole |
MF |
C10H10BrN3 |
Molekulatömeg |
252.1105 |
InChI |
InChI=1/C10H10BrN3/c1-8-10(7-11)13-14(12-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
CAS-szám |
13322-02-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.49g/cm3 |
Olvadáspont |
72℃ |
Forráspont |
378.4°C at 760 mmHg |
Törésmutató |
1.643 |
Gyulladáspont |
182.6°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|