ChemNet > CAS > 13324-11-3 Methyl 2-chloro-4-nitrobenzoate
13324-11-3 Methyl 2-chloro-4-nitrobenzoate
termék neve |
Methyl 2-chloro-4-nitrobenzoate |
Szinonimák |
2-Chloro-4-nitrobenzoic acid methyl ester |
MF |
C8H6ClNO4 |
Molekulatömeg |
215.5905 |
InChI |
InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(10(12)13)4-7(6)9/h2-4H,1H3 |
CAS-szám |
13324-11-3 |
EINECS |
236-362-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.426g/cm3 |
Olvadáspont |
74-75℃ |
Forráspont |
324.8°C at 760 mmHg |
Törésmutató |
1.568 |
Gyulladáspont |
150.2°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|