ChemNet > CAS > 13888-77-2 (pentafluorophenyl)dimethylsilane
13888-77-2 (pentafluorophenyl)dimethylsilane
termék neve |
(pentafluorophenyl)dimethylsilane |
Szinonimák |
Dimethyl(pentafluorophenyl)silane |
MF |
C8H7F5Si |
Molekulatömeg |
226.2187 |
InChI |
InChI=1/C8H7F5Si/c1-14(2)8-6(12)4(10)3(9)5(11)7(8)13/h14H,1-2H3 |
CAS-szám |
13888-77-2 |
Molekuláris szerkezete |
|
Forráspont |
163.8°C at 760 mmHg |
Gyulladáspont |
40.6°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|