ChemNet > CAS > 14572-89-5 1-(4-Aminophenyl)ethanol
14572-89-5 1-(4-Aminophenyl)ethanol
termék neve |
1-(4-Aminophenyl)ethanol |
Szinonimák |
4-Amino-alpha-methylbenzyl alcohol~4-Aminophenyl methyl carbinol~4-(alpha-Hydroxyethyl)aniline; (1S)-1-(4-aminophenyl)ethanol; (1R)-1-(4-aminophenyl)ethanol |
MF |
C8H11NO |
Molekulatömeg |
137.179 |
InChI |
InChI=1/C8H11NO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,9H2,1H3/t6-/m1/s1 |
CAS-szám |
14572-89-5 |
EINECS |
238-613-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.117g/cm3 |
Forráspont |
288.5°C at 760 mmHg |
Törésmutató |
1.592 |
Gyulladáspont |
128.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|