ChemNet > CAS > 14984-21-5 Bis(4-phenoxyphenyl)methanone
14984-21-5 Bis(4-phenoxyphenyl)methanone
termék neve |
Bis(4-phenoxyphenyl)methanone |
Szinonimák |
4,4-Diphenoxybenzophenone; 4,4'-Diphenoxybenzophenone |
MF |
C25H18O3 |
Molekulatömeg |
366.4086 |
InChI |
InChI=1/C25H18O3/c26-25(19-11-15-23(16-12-19)27-21-7-3-1-4-8-21)20-13-17-24(18-14-20)28-22-9-5-2-6-10-22/h1-18H |
CAS-szám |
14984-21-5 |
EINECS |
403-390-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.186g/cm3 |
Forráspont |
514.4°C at 760 mmHg |
Törésmutató |
1.623 |
Gyulladáspont |
257.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|