ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
termék neve |
2,6-Dimethoxybenzonitrile |
Szinonimák |
Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
MF |
C9H9NO2 |
Molekulatömeg |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
CAS-szám |
16932-49-3 |
EINECS |
241-000-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.12g/cm3 |
Olvadáspont |
119-123℃ |
Forráspont |
306.7°C at 760 mmHg |
Törésmutató |
1.519 |
Gyulladáspont |
128.8°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|