ChemNet > CAS > 1722-10-7 3-Chloro-6-methoxypyridazine
1722-10-7 3-Chloro-6-methoxypyridazine
| termék neve |
3-Chloro-6-methoxypyridazine |
| MF |
C5H5ClN2O |
| Molekulatömeg |
144.559 |
| InChI |
InChI=1/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
| CAS-szám |
1722-10-7 |
| EINECS |
217-019-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.292g/cm3 |
| Olvadáspont |
85-92℃ |
| Forráspont |
284.9°C at 760 mmHg |
| Törésmutató |
1.52 |
| Gyulladáspont |
126.1°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
